About (4-aminoquinazolin-2-yl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate
(4-aminoquinazolin-2-yl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate (PubChem CID 27908304) has the molecular formula C19H15N5O4
and a molecular weight of 377.36 g/mol. Its IUPAC name is (4-aminoquinazolin-2-yl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate.
Molecular Properties
| Compound Name | (4-aminoquinazolin-2-yl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate |
| PubChem CID | 27908304 |
| Molecular Formula | C19H15N5O4 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | (4-aminoquinazolin-2-yl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate |
| SMILES | Nc1nc(COC(=O)Cn2[nH]c(=O)c3ccccc3c2=O)nc2ccccc12 |
| InChI | InChI=1S/C19H15N5O4/c20-17-13-7-3-4-8-14(13)21-15(22-17)10-28-16(25)9-24-19(27)12-6-2-1-5-11(12)18(26)23-24/h1-8H,9-10H2,(H,23,26)(H2,20,21,22) |
| InChIKey | WSEBJLFJLVZDHT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (4-aminoquinazolin-2-yl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminoquinazolin-2-yl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate?
The IUPAC name of (4-aminoquinazolin-2-yl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate (CID 27908304) is (4-aminoquinazolin-2-yl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate.
What is the SMILES notation for (4-aminoquinazolin-2-yl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate?
The canonical SMILES for (4-aminoquinazolin-2-yl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate is Nc1nc(COC(=O)Cn2[nH]c(=O)c3ccccc3c2=O)nc2ccccc12.
What is the InChIKey of (4-aminoquinazolin-2-yl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate?
The InChIKey is WSEBJLFJLVZDHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N5O4/c20-17-13-7-3-4-8-14(13)21-15(22-17)10-28-16(25)9-24-19(27)12-6-2-1-5-11(12)18(26)23-24/h1-8H,9-10H2,(H,23,26)(H2,20,21,22).
What are the key properties of (4-aminoquinazolin-2-yl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate?
(4-aminoquinazolin-2-yl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate has a molecular weight of 377.36 g/mol, XLogP of 0.96, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminoquinazolin-2-yl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate is sourced from PubChem (CID 27908304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).