C18H15N3O5 — CID 2619355
(2-anilino-2-oxoethyl) 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate (PubChem CID 2619355) has the molecular formula C18H15N3O5 and a molecular weight of 353.33 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate.
| Compound Name | (2-anilino-2-oxoethyl) 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate |
|---|---|
| PubChem CID | 2619355 |
| Molecular Formula | C18H15N3O5 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | (2-anilino-2-oxoethyl) 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate |
| SMILES | O=C(COC(=O)Cn1[nH]c(=O)c2ccccc2c1=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H15N3O5/c22-15(19-12-6-2-1-3-7-12)11-26-16(23)10-21-18(25)14-9-5-4-8-13(14)17(24)20-21/h1-9H,10-11H2,(H,19,22)(H,20,24) |
| InChIKey | BFLKFJRKUAYQAP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |