C21H15N5O5 — CID 2416177
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate (PubChem CID 2416177) has the molecular formula C21H15N5O5 and a molecular weight of 417.38 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate |
|---|---|
| PubChem CID | 2416177 |
| Molecular Formula | C21H15N5O5 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate |
| SMILES | N#CC(=C(O)COC(=O)Cn1[nH]c(=O)c2ccccc2c1=O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H15N5O5/c22-9-14(19-23-15-7-3-4-8-16(15)24-19)17(27)11-31-18(28)10-26-21(30)13-6-2-1-5-12(13)20(29)25-26/h1-8,27H,10-11H2,(H,23,24)(H,25,29) |
| InChIKey | OMUFECACIVWSFK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 153.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|