C21H23N5O2 — CID 38727411
(4-aminoquinazolin-2-yl)methyl 6-(azepan-1-yl)pyridine-3-carboxylate (PubChem CID 38727411) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is (4-aminoquinazolin-2-yl)methyl 6-(azepan-1-yl)pyridine-3-carboxylate.
| Compound Name | (4-aminoquinazolin-2-yl)methyl 6-(azepan-1-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 38727411 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | (4-aminoquinazolin-2-yl)methyl 6-(azepan-1-yl)pyridine-3-carboxylate |
| SMILES | Nc1nc(COC(=O)c2ccc(N3CCCCCC3)nc2)nc2ccccc12 |
| InChI | InChI=1S/C21H23N5O2/c22-20-16-7-3-4-8-17(16)24-18(25-20)14-28-21(27)15-9-10-19(23-13-15)26-11-5-1-2-6-12-26/h3-4,7-10,13H,1-2,5-6,11-12,14H2,(H2,22,24,25) |
| InChIKey | PGJWFUCDVUTQMP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |