C18H17N3O4 — CID 9451142
(4-aminoquinazolin-2-yl)methyl 2,6-dimethoxybenzoate (PubChem CID 9451142) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is (4-aminoquinazolin-2-yl)methyl 2,6-dimethoxybenzoate.
| Compound Name | (4-aminoquinazolin-2-yl)methyl 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 9451142 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (4-aminoquinazolin-2-yl)methyl 2,6-dimethoxybenzoate |
| SMILES | COc1cccc(OC)c1C(=O)OCc1nc(N)c2ccccc2n1 |
| InChI | InChI=1S/C18H17N3O4/c1-23-13-8-5-9-14(24-2)16(13)18(22)25-10-15-20-12-7-4-3-6-11(12)17(19)21-15/h3-9H,10H2,1-2H3,(H2,19,20,21) |
| InChIKey | NZUVDJXAZQETIF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 96.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |