C17H21NO7 — CID 56504972
2-O-[2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 1-O-methyl benzene-1,2-dicarboxylate (PubChem CID 56504972) has the molecular formula C17H21NO7 and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-O-[2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 1-O-methyl benzene-1,2-dicarboxylate.
| Compound Name | 2-O-[2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 1-O-methyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 56504972 |
| Molecular Formula | C17H21NO7 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-O-[2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 1-O-methyl benzene-1,2-dicarboxylate |
| SMILES | CCOC(=O)CCCNC(=O)COC(=O)c1ccccc1C(=O)OC |
| InChI | InChI=1S/C17H21NO7/c1-3-24-15(20)9-6-10-18-14(19)11-25-17(22)13-8-5-4-7-12(13)16(21)23-2/h4-5,7-8H,3,6,9-11H2,1-2H3,(H,18,19) |
| InChIKey | KPUWSZCDJCYBTB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|