C18H24N2O9 — CID 35350220
[2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 5-ethoxy-4-methoxy-2-nitrobenzoate (PubChem CID 35350220) has the molecular formula C18H24N2O9 and a molecular weight of 412.40 g/mol. Its IUPAC name is [2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 5-ethoxy-4-methoxy-2-nitrobenzoate.
| Compound Name | [2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 5-ethoxy-4-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 35350220 |
| Molecular Formula | C18H24N2O9 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 5-ethoxy-4-methoxy-2-nitrobenzoate |
| SMILES | CCOC(=O)CCCNC(=O)COC(=O)c1cc(OCC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H24N2O9/c1-4-27-15-9-12(13(20(24)25)10-14(15)26-3)18(23)29-11-16(21)19-8-6-7-17(22)28-5-2/h9-10H,4-8,11H2,1-3H3,(H,19,21) |
| InChIKey | UZJRNSBANLWFJY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|