C24H25N3O6S — CID 42106461
[2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 42106461) has the molecular formula C24H25N3O6S and a molecular weight of 483.55 g/mol. Its IUPAC name is [2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | [2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 42106461 |
| Molecular Formula | C24H25N3O6S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | [2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | CCOC(=O)CCCNC(=O)COC(=O)c1ccccc1SCC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C24H25N3O6S/c1-2-32-23(30)11-6-12-26-21(28)15-33-24(31)19-9-3-4-10-20(19)34-16-22(29)27-18-8-5-7-17(13-18)14-25/h3-5,7-10,13H,2,6,11-12,15-16H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | QEXHEEJPQOKRPN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 134.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|