C20H20N4O3S — CID 9224561
2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanyl-N-[2-(ethylamino)-2-oxoethyl]benzamide (PubChem CID 9224561) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanyl-N-[2-(ethylamino)-2-oxoethyl]benzamide.
| Compound Name | 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanyl-N-[2-(ethylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9224561 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanyl-N-[2-(ethylamino)-2-oxoethyl]benzamide |
| SMILES | CCNC(=O)CNC(=O)c1ccccc1SCC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C20H20N4O3S/c1-2-22-18(25)12-23-20(27)16-8-3-4-9-17(16)28-13-19(26)24-15-7-5-6-14(10-15)11-21/h3-10H,2,12-13H2,1H3,(H,22,25)(H,23,27)(H,24,26) |
| InChIKey | ZJUKEVWYLFXJRS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |