C28H22N4O2S — CID 112768763
2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanyl-N-[4-(pyridin-4-ylmethyl)phenyl]benzamide (PubChem CID 112768763) has the molecular formula C28H22N4O2S and a molecular weight of 478.58 g/mol. Its IUPAC name is 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanyl-N-[4-(pyridin-4-ylmethyl)phenyl]benzamide.
| Compound Name | 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanyl-N-[4-(pyridin-4-ylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 112768763 |
| Molecular Formula | C28H22N4O2S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanyl-N-[4-(pyridin-4-ylmethyl)phenyl]benzamide |
| SMILES | N#Cc1cccc(NC(=O)CSc2ccccc2C(=O)Nc2ccc(Cc3ccncc3)cc2)c1 |
| InChI | InChI=1S/C28H22N4O2S/c29-18-22-4-3-5-24(17-22)31-27(33)19-35-26-7-2-1-6-25(26)28(34)32-23-10-8-20(9-11-23)16-21-12-14-30-15-13-21/h1-15,17H,16,19H2,(H,31,33)(H,32,34) |
| InChIKey | SJOULHGCGRTPAJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |