C23H21NO5 — CID 7703196
[2-oxo-2-(4-phenylmethoxyanilino)ethyl] 3-methoxybenzoate (PubChem CID 7703196) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylmethoxyanilino)ethyl] 3-methoxybenzoate.
| Compound Name | [2-oxo-2-(4-phenylmethoxyanilino)ethyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 7703196 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | [2-oxo-2-(4-phenylmethoxyanilino)ethyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCC(=O)Nc2ccc(OCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C23H21NO5/c1-27-21-9-5-8-18(14-21)23(26)29-16-22(25)24-19-10-12-20(13-11-19)28-15-17-6-3-2-4-7-17/h2-14H,15-16H2,1H3,(H,24,25) |
| InChIKey | CCZZMILCVRZPAQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |