C16H22N2O6 — CID 7856622
[2-(ethylcarbamoylamino)-2-oxoethyl] 3-(2-ethoxyphenoxy)propanoate (PubChem CID 7856622) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] 3-(2-ethoxyphenoxy)propanoate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 3-(2-ethoxyphenoxy)propanoate |
|---|---|
| PubChem CID | 7856622 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 3-(2-ethoxyphenoxy)propanoate |
| SMILES | CCNC(=O)NC(=O)COC(=O)CCOc1ccccc1OCC |
| InChI | InChI=1S/C16H22N2O6/c1-3-17-16(21)18-14(19)11-24-15(20)9-10-23-13-8-6-5-7-12(13)22-4-2/h5-8H,3-4,9-11H2,1-2H3,(H2,17,18,19,21) |
| InChIKey | HXWJHRXPYBACAG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |