C18H20N4O4 — CID 30885928
[2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate (PubChem CID 30885928) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate.
| Compound Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 30885928 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate |
| SMILES | CCC(=O)Nc1ccc(C(=O)COC(=O)CN(C)c2ncccn2)cc1 |
| InChI | InChI=1S/C18H20N4O4/c1-3-16(24)21-14-7-5-13(6-8-14)15(23)12-26-17(25)11-22(2)18-19-9-4-10-20-18/h4-10H,3,11-12H2,1-2H3,(H,21,24) |
| InChIKey | IKYVHYWLFXYVAN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |