C24H25NO5 — CID 31260462
methyl 4-[(E)-3-oxo-3-[2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethoxy]prop-1-enyl]benzoate (PubChem CID 31260462) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is methyl 4-[(E)-3-oxo-3-[2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethoxy]prop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-3-oxo-3-[2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethoxy]prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 31260462 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | methyl 4-[(E)-3-oxo-3-[2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethoxy]prop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/C(=O)OCC(=O)NCC2(c3ccccc3)CCC2)cc1 |
| InChI | InChI=1S/C24H25NO5/c1-29-23(28)19-11-8-18(9-12-19)10-13-22(27)30-16-21(26)25-17-24(14-5-15-24)20-6-3-2-4-7-20/h2-4,6-13H,5,14-17H2,1H3,(H,25,26)/b13-10+ |
| InChIKey | JCDZAMYTSDOSMM-JLHYYAGUSA-N |
| XLogP | 3.27 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|