C25H29NO6 — CID 31639334
[2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethyl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 31639334) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is [2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethyl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethyl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 31639334 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | [2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethyl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/C(=O)OCC(=O)NCC1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C25H29NO6/c1-29-20-15-22(31-3)21(30-2)14-18(20)10-11-24(28)32-16-23(27)26-17-25(12-7-13-25)19-8-5-4-6-9-19/h4-6,8-11,14-15H,7,12-13,16-17H2,1-3H3,(H,26,27)/b11-10+ |
| InChIKey | YRGOYLBJCMAERF-ZHACJKMWSA-N |
| XLogP | 3.51 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|