C19H22N2O5 — CID 7210667
[2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 4-(2-methylpropoxy)benzoate (PubChem CID 7210667) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 4-(2-methylpropoxy)benzoate.
| Compound Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 4-(2-methylpropoxy)benzoate |
|---|---|
| PubChem CID | 7210667 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 4-(2-methylpropoxy)benzoate |
| SMILES | CC(C)COc1ccc(C(=O)OCC(=O)NC(=O)c2cccn2C)cc1 |
| InChI | InChI=1S/C19H22N2O5/c1-13(2)11-25-15-8-6-14(7-9-15)19(24)26-12-17(22)20-18(23)16-5-4-10-21(16)3/h4-10,13H,11-12H2,1-3H3,(H,20,22,23) |
| InChIKey | OOWKXWUFBNJLGF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |