C16H17N3O6S — CID 16543101
[2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 3-(methanesulfonamido)benzoate (PubChem CID 16543101) has the molecular formula C16H17N3O6S and a molecular weight of 379.39 g/mol. Its IUPAC name is [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 3-(methanesulfonamido)benzoate.
| Compound Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 3-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 16543101 |
| Molecular Formula | C16H17N3O6S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 3-(methanesulfonamido)benzoate |
| SMILES | Cn1cccc1C(=O)NC(=O)COC(=O)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H17N3O6S/c1-19-8-4-7-13(19)15(21)17-14(20)10-25-16(22)11-5-3-6-12(9-11)18-26(2,23)24/h3-9,18H,10H2,1-2H3,(H,17,20,21) |
| InChIKey | MHLXDSJTYOWSHG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |