C15H16N2O5S — CID 8740721
[2-(3-methylsulfonylanilino)-2-oxoethyl] 1-methylpyrrole-2-carboxylate (PubChem CID 8740721) has the molecular formula C15H16N2O5S and a molecular weight of 336.37 g/mol. Its IUPAC name is [2-(3-methylsulfonylanilino)-2-oxoethyl] 1-methylpyrrole-2-carboxylate.
| Compound Name | [2-(3-methylsulfonylanilino)-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 8740721 |
| Molecular Formula | C15H16N2O5S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | [2-(3-methylsulfonylanilino)-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
| SMILES | Cn1cccc1C(=O)OCC(=O)Nc1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H16N2O5S/c1-17-8-4-7-13(17)15(19)22-10-14(18)16-11-5-3-6-12(9-11)23(2,20)21/h3-9H,10H2,1-2H3,(H,16,18) |
| InChIKey | HPNNQWKBCJLQSW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |