C22H20N6O4 — CID 42577269
[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 42577269) has the molecular formula C22H20N6O4 and a molecular weight of 432.44 g/mol. Its IUPAC name is [4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 42577269 |
| Molecular Formula | C22H20N6O4 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | [4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl 2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccccc1N1C(=O)c2ccc(C(=O)OCc3nc(N)nc(N(C)C)n3)cc2C1=O |
| InChI | InChI=1S/C22H20N6O4/c1-12-6-4-5-7-16(12)28-18(29)14-9-8-13(10-15(14)19(28)30)20(31)32-11-17-24-21(23)26-22(25-17)27(2)3/h4-10H,11H2,1-3H3,(H2,23,24,25,26) |
| InChIKey | CIXWJBMWCMBKFX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 131.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|