C14H16N6O4 — CID 41478164
[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl 3-methyl-4-nitrobenzoate (PubChem CID 41478164) has the molecular formula C14H16N6O4 and a molecular weight of 332.32 g/mol. Its IUPAC name is [4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl 3-methyl-4-nitrobenzoate.
| Compound Name | [4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl 3-methyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 41478164 |
| Molecular Formula | C14H16N6O4 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | [4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl 3-methyl-4-nitrobenzoate |
| SMILES | Cc1cc(C(=O)OCc2nc(N)nc(N(C)C)n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16N6O4/c1-8-6-9(4-5-10(8)20(22)23)12(21)24-7-11-16-13(15)18-14(17-11)19(2)3/h4-6H,7H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | FCLPGUYANJFKHR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 137.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|