About 3-iodoprop-2-ynyl 3-methyl-4-nitrobenzoate
3-iodoprop-2-ynyl 3-methyl-4-nitrobenzoate (PubChem CID 23469143) has the molecular formula C11H8INO4
and a molecular weight of 345.09 g/mol. Its IUPAC name is 3-iodoprop-2-ynyl 3-methyl-4-nitrobenzoate.
Molecular Properties
| Compound Name | 3-iodoprop-2-ynyl 3-methyl-4-nitrobenzoate |
| PubChem CID | 23469143 |
| Molecular Formula | C11H8INO4 |
| Molecular Weight | 345.09 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | 3-iodoprop-2-ynyl 3-methyl-4-nitrobenzoate |
| SMILES | Cc1cc(C(=O)OCC#CI)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H8INO4/c1-8-7-9(3-4-10(8)13(15)16)11(14)17-6-2-5-12/h3-4,7H,6H2,1H3 |
| InChIKey | UCYNKQSBGUTJKR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.09 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-iodoprop-2-ynyl 3-methyl-4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodoprop-2-ynyl 3-methyl-4-nitrobenzoate?
The IUPAC name of 3-iodoprop-2-ynyl 3-methyl-4-nitrobenzoate (CID 23469143) is 3-iodoprop-2-ynyl 3-methyl-4-nitrobenzoate.
What is the SMILES notation for 3-iodoprop-2-ynyl 3-methyl-4-nitrobenzoate?
The canonical SMILES for 3-iodoprop-2-ynyl 3-methyl-4-nitrobenzoate is Cc1cc(C(=O)OCC#CI)ccc1[N+](=O)[O-].
What is the InChIKey of 3-iodoprop-2-ynyl 3-methyl-4-nitrobenzoate?
The InChIKey is UCYNKQSBGUTJKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8INO4/c1-8-7-9(3-4-10(8)13(15)16)11(14)17-6-2-5-12/h3-4,7H,6H2,1H3.
What are the key properties of 3-iodoprop-2-ynyl 3-methyl-4-nitrobenzoate?
3-iodoprop-2-ynyl 3-methyl-4-nitrobenzoate has a molecular weight of 345.09 g/mol, XLogP of 2.46, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodoprop-2-ynyl 3-methyl-4-nitrobenzoate is sourced from PubChem (CID 23469143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).