C21H20N6O6 — CID 146513914
[4-[N-(acetyloxymethyl)-4-methylanilino]-6-amino-1,3,5-triazin-2-yl]methyl 4-nitrobenzoate (PubChem CID 146513914) has the molecular formula C21H20N6O6 and a molecular weight of 452.43 g/mol. Its IUPAC name is [4-[N-(acetyloxymethyl)-4-methylanilino]-6-amino-1,3,5-triazin-2-yl]methyl 4-nitrobenzoate.
| Compound Name | [4-[N-(acetyloxymethyl)-4-methylanilino]-6-amino-1,3,5-triazin-2-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 146513914 |
| Molecular Formula | C21H20N6O6 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | [4-[N-(acetyloxymethyl)-4-methylanilino]-6-amino-1,3,5-triazin-2-yl]methyl 4-nitrobenzoate |
| SMILES | CC(=O)OCN(c1ccc(C)cc1)c1nc(N)nc(COC(=O)c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C21H20N6O6/c1-13-3-7-16(8-4-13)26(12-33-14(2)28)21-24-18(23-20(22)25-21)11-32-19(29)15-5-9-17(10-6-15)27(30)31/h3-10H,11-12H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | MXVYUDUPWIIUND-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 163.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|