C22H23N5O4 — CID 157184503
[4-[N-(acetyloxymethyl)-4-methylanilino]-6-amino-1,3,5-triazin-2-yl]methyl 4-methylbenzoate (PubChem CID 157184503) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is [4-[N-(acetyloxymethyl)-4-methylanilino]-6-amino-1,3,5-triazin-2-yl]methyl 4-methylbenzoate.
| Compound Name | [4-[N-(acetyloxymethyl)-4-methylanilino]-6-amino-1,3,5-triazin-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 157184503 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | [4-[N-(acetyloxymethyl)-4-methylanilino]-6-amino-1,3,5-triazin-2-yl]methyl 4-methylbenzoate |
| SMILES | CC(=O)OCN(c1ccc(C)cc1)c1nc(N)nc(COC(=O)c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C22H23N5O4/c1-14-4-8-17(9-5-14)20(29)30-12-19-24-21(23)26-22(25-19)27(13-31-16(3)28)18-10-6-15(2)7-11-18/h4-11H,12-13H2,1-3H3,(H2,23,24,25,26) |
| InChIKey | DANSWHWPFYDKJS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 120.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|