C17H15N3O3 — CID 9404315
4-[3-(1,3-benzoxazol-2-yl)propanoylamino]benzamide (PubChem CID 9404315) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is 4-[3-(1,3-benzoxazol-2-yl)propanoylamino]benzamide.
| Compound Name | 4-[3-(1,3-benzoxazol-2-yl)propanoylamino]benzamide |
|---|---|
| PubChem CID | 9404315 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 4-[3-(1,3-benzoxazol-2-yl)propanoylamino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)CCc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C17H15N3O3/c18-17(22)11-5-7-12(8-6-11)19-15(21)9-10-16-20-13-3-1-2-4-14(13)23-16/h1-8H,9-10H2,(H2,18,22)(H,19,21) |
| InChIKey | JEQYZOIMBWQGNK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |