C20H23N3O4S — CID 9020862
3-(1,3-benzoxazol-2-yl)-N-[3-(tert-butylsulfamoyl)phenyl]propanamide (PubChem CID 9020862) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-N-[3-(tert-butylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-N-[3-(tert-butylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 9020862 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-N-[3-(tert-butylsulfamoyl)phenyl]propanamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cccc(NC(=O)CCc2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C20H23N3O4S/c1-20(2,3)23-28(25,26)15-8-6-7-14(13-15)21-18(24)11-12-19-22-16-9-4-5-10-17(16)27-19/h4-10,13,23H,11-12H2,1-3H3,(H,21,24) |
| InChIKey | TZRFNOCJCIZXFY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |