C24H19N3O4 — CID 41427750
[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]methyl 2-(1H-indol-3-yl)acetate (PubChem CID 41427750) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is [3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]methyl 2-(1H-indol-3-yl)acetate.
| Compound Name | [3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]methyl 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 41427750 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | [3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]methyl 2-(1H-indol-3-yl)acetate |
| SMILES | O=C(Cc1c[nH]c2ccccc12)OCc1nc2ccccc2c(=O)n1Cc1ccco1 |
| InChI | InChI=1S/C24H19N3O4/c28-23(12-16-13-25-20-9-3-1-7-18(16)20)31-15-22-26-21-10-4-2-8-19(21)24(29)27(22)14-17-6-5-11-30-17/h1-11,13,25H,12,14-15H2 |
| InChIKey | OTZGYYLMRZVOLI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |