C20H17N3O3 — CID 135734801
(4-oxo-3H-quinazolin-2-yl)methyl 3-(1H-indol-3-yl)propanoate (PubChem CID 135734801) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is (4-oxo-3H-quinazolin-2-yl)methyl 3-(1H-indol-3-yl)propanoate.
| Compound Name | (4-oxo-3H-quinazolin-2-yl)methyl 3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 135734801 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (4-oxo-3H-quinazolin-2-yl)methyl 3-(1H-indol-3-yl)propanoate |
| SMILES | O=C(CCc1c[nH]c2ccccc12)OCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H17N3O3/c24-19(10-9-13-11-21-16-7-3-1-5-14(13)16)26-12-18-22-17-8-4-2-6-15(17)20(25)23-18/h1-8,11,21H,9-10,12H2,(H,22,23,25) |
| InChIKey | RZYBHZHYQAJTFP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |