C14H10N4O8S — CID 55643982
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 5-sulfamoylfuran-2-carboxylate (PubChem CID 55643982) has the molecular formula C14H10N4O8S and a molecular weight of 394.32 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 5-sulfamoylfuran-2-carboxylate.
| Compound Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 5-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55643982 |
| Molecular Formula | C14H10N4O8S |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 5-sulfamoylfuran-2-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(C(=O)OCc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)o1 |
| InChI | InChI=1S/C14H10N4O8S/c15-27(22,23)12-6-5-10(25-12)14(19)24-7-11-16-17-13(26-11)8-1-3-9(4-2-8)18(20)21/h1-6H,7H2,(H2,15,22,23) |
| InChIKey | NPLOWJPWNMOJCW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 181.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|