C11H9ClN4O4 — CID 61053482
5-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-nitrobenzamide (PubChem CID 61053482) has the molecular formula C11H9ClN4O4 and a molecular weight of 296.67 g/mol. Its IUPAC name is 5-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-nitrobenzamide.
| Compound Name | 5-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 61053482 |
| Molecular Formula | C11H9ClN4O4 |
| Molecular Weight | 296.67 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 5-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2-nitrobenzamide |
| SMILES | Cc1noc(CNC(=O)c2cc(Cl)ccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C11H9ClN4O4/c1-6-14-10(20-15-6)5-13-11(17)8-4-7(12)2-3-9(8)16(18)19/h2-4H,5H2,1H3,(H,13,17) |
| InChIKey | DGJFRZPWPAVDOY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.67 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|