C21H21N3O4 — CID 30393854
[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methyl 2-benzamidobenzoate (PubChem CID 30393854) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is [3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methyl 2-benzamidobenzoate.
| Compound Name | [3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methyl 2-benzamidobenzoate |
|---|---|
| PubChem CID | 30393854 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methyl 2-benzamidobenzoate |
| SMILES | CC(C)Cc1noc(COC(=O)c2ccccc2NC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C21H21N3O4/c1-14(2)12-18-23-19(28-24-18)13-27-21(26)16-10-6-7-11-17(16)22-20(25)15-8-4-3-5-9-15/h3-11,14H,12-13H2,1-2H3,(H,22,25) |
| InChIKey | UFJCHUNRDPASOX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |