C25H15ClN2O5 — CID 42972946
[1-(2-cyanoanilino)-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 42972946) has the molecular formula C25H15ClN2O5 and a molecular weight of 458.86 g/mol. Its IUPAC name is [1-(2-cyanoanilino)-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [1-(2-cyanoanilino)-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 42972946 |
| Molecular Formula | C25H15ClN2O5 |
| Molecular Weight | 458.86 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | [1-(2-cyanoanilino)-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc2c(c1Cl)C(=O)c1ccccc1C2=O)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C25H15ClN2O5/c1-13(24(31)28-19-9-5-2-6-14(19)12-27)33-25(32)18-11-10-17-20(21(18)26)23(30)16-8-4-3-7-15(16)22(17)29/h2-11,13H,1H3,(H,28,31) |
| InChIKey | ICGSYXCJDVFMCG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.86 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|