C25H16ClNO7 — CID 42968491
[1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 42968491) has the molecular formula C25H16ClNO7 and a molecular weight of 477.86 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 42968491 |
| Molecular Formula | C25H16ClNO7 |
| Molecular Weight | 477.86 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | [1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc2c(c1Cl)C(=O)c1ccccc1C2=O)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H16ClNO7/c1-12(24(30)27-13-6-9-18-19(10-13)33-11-32-18)34-25(31)17-8-7-16-20(21(17)26)23(29)15-5-3-2-4-14(15)22(16)28/h2-10,12H,11H2,1H3,(H,27,30) |
| InChIKey | PJTSVRCYRSJRKE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.86 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|