C25H15ClF2O6 — CID 16521495
[1-[4-(difluoromethoxy)phenyl]-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 16521495) has the molecular formula C25H15ClF2O6 and a molecular weight of 484.84 g/mol. Its IUPAC name is [1-[4-(difluoromethoxy)phenyl]-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [1-[4-(difluoromethoxy)phenyl]-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 16521495 |
| Molecular Formula | C25H15ClF2O6 |
| Molecular Weight | 484.84 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | [1-[4-(difluoromethoxy)phenyl]-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc2c(c1Cl)C(=O)c1ccccc1C2=O)C(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C25H15ClF2O6/c1-12(21(29)13-6-8-14(9-7-13)34-25(27)28)33-24(32)18-11-10-17-19(20(18)26)23(31)16-5-3-2-4-15(16)22(17)30/h2-12,25H,1H3 |
| InChIKey | LOJLPZGNVIAZRL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.84 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|