C23H20ClNO7S — CID 16595684
[1-[(1,1-dioxothiolan-3-yl)-methylamino]-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 16595684) has the molecular formula C23H20ClNO7S and a molecular weight of 489.93 g/mol. Its IUPAC name is [1-[(1,1-dioxothiolan-3-yl)-methylamino]-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [1-[(1,1-dioxothiolan-3-yl)-methylamino]-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 16595684 |
| Molecular Formula | C23H20ClNO7S |
| Molecular Weight | 489.93 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | [1-[(1,1-dioxothiolan-3-yl)-methylamino]-1-oxopropan-2-yl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc2c(c1Cl)C(=O)c1ccccc1C2=O)C(=O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H20ClNO7S/c1-12(22(28)25(2)13-9-10-33(30,31)11-13)32-23(29)17-8-7-16-18(19(17)24)21(27)15-6-4-3-5-14(15)20(16)26/h3-8,12-13H,9-11H2,1-2H3 |
| InChIKey | NOZTZKRSUVZREQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 114.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.93 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|