C14H8F5NO — CID 2524391
N-(2,4-difluorophenyl)-2-(trifluoromethyl)benzamide (PubChem CID 2524391) has the molecular formula C14H8F5NO and a molecular weight of 301.21 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(trifluoromethyl)benzamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 2524391 |
| Molecular Formula | C14H8F5NO |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H8F5NO/c15-8-5-6-12(11(16)7-8)20-13(21)9-3-1-2-4-10(9)14(17,18)19/h1-7H,(H,20,21) |
| InChIKey | CNYRTIXREHRXTP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |