C21H13F5N2O5 — CID 174756942
[2-[(2,4-difluorophenyl)carbamoyl]-6-(trifluoromethyl)phenyl] formate;nitrobenzene (PubChem CID 174756942) has the molecular formula C21H13F5N2O5 and a molecular weight of 468.33 g/mol. Its IUPAC name is [2-[(2,4-difluorophenyl)carbamoyl]-6-(trifluoromethyl)phenyl] formate;nitrobenzene.
| Compound Name | [2-[(2,4-difluorophenyl)carbamoyl]-6-(trifluoromethyl)phenyl] formate;nitrobenzene |
|---|---|
| PubChem CID | 174756942 |
| Molecular Formula | C21H13F5N2O5 |
| Molecular Weight | 468.33 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | [2-[(2,4-difluorophenyl)carbamoyl]-6-(trifluoromethyl)phenyl] formate;nitrobenzene |
| SMILES | O=COc1c(C(=O)Nc2ccc(F)cc2F)cccc1C(F)(F)F.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C15H8F5NO3.C6H5NO2/c16-8-4-5-12(11(17)6-8)21-14(23)9-2-1-3-10(15(18,19)20)13(9)24-7-22;8-7(9)6-4-2-1-3-5-6/h1-7H,(H,21,23);1-5H |
| InChIKey | OXGBUWJCRBZZOM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.33 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|