C15H15F2N2O4S+ — CID 20850610
[2-[(2,4-difluorophenyl)carbamoyl]phenyl]-dimethyl-sulfoazanium (PubChem CID 20850610) has the molecular formula C15H15F2N2O4S+ and a molecular weight of 357.36 g/mol. Its IUPAC name is [2-[(2,4-difluorophenyl)carbamoyl]phenyl]-dimethyl-sulfoazanium.
| Compound Name | [2-[(2,4-difluorophenyl)carbamoyl]phenyl]-dimethyl-sulfoazanium |
|---|---|
| PubChem CID | 20850610 |
| Molecular Formula | C15H15F2N2O4S+ |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | [2-[(2,4-difluorophenyl)carbamoyl]phenyl]-dimethyl-sulfoazanium |
| SMILES | C[N+](C)(c1ccccc1C(=O)Nc1ccc(F)cc1F)S(=O)(=O)O |
| InChI | InChI=1S/C15H14F2N2O4S/c1-19(2,24(21,22)23)14-6-4-3-5-11(14)15(20)18-13-8-7-10(16)9-12(13)17/h3-9H,1-2H3,(H-,18,20,21,22,23)/p+1 |
| InChIKey | SVUITFDXOHKRJI-UHFFFAOYSA-O |
| XLogP | 2.59 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|