C17H11Br2N3O2S2 — CID 42805848
2-bromo-N-[5-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 42805848) has the molecular formula C17H11Br2N3O2S2 and a molecular weight of 513.24 g/mol. Its IUPAC name is 2-bromo-N-[5-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-bromo-N-[5-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 42805848 |
| Molecular Formula | C17H11Br2N3O2S2 |
| Molecular Weight | 513.24 g/mol |
| Exact Mass | 510.87 |
| IUPAC Name | 2-bromo-N-[5-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2ccccc2Br)s1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H11Br2N3O2S2/c18-11-7-5-10(6-8-11)14(23)9-25-17-22-21-16(26-17)20-15(24)12-3-1-2-4-13(12)19/h1-8H,9H2,(H,20,21,24) |
| InChIKey | ZQUFYKUFQCTKQS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.24 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|