C20H16BrN3O2S2 — CID 93126138
cis-(1S,2R)-N-[5-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-phenylcyclopropane-1-carboxamide (PubChem CID 93126138) has the molecular formula C20H16BrN3O2S2 and a molecular weight of 474.41 g/mol. Its IUPAC name is cis-(1S,2R)-N-[5-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-[5-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 93126138 |
| Molecular Formula | C20H16BrN3O2S2 |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 472.99 |
| IUPAC Name | cis-(1S,2R)-N-[5-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(CSc1nnc(NC(=O)[C@H]2C[C@H]2c2ccccc2)s1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H16BrN3O2S2/c21-14-8-6-13(7-9-14)17(25)11-27-20-24-23-19(28-20)22-18(26)16-10-15(16)12-4-2-1-3-5-12/h1-9,15-16H,10-11H2,(H,22,23,26)/t15-,16-/m0/s1 |
| InChIKey | SJLRDMFEIJBVGD-HOTGVXAUSA-N |
| XLogP | 5.02 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|