C22H23N3OS2 — CID 11922985
cis-(1S,2R)-2-phenyl-N-[5-[(4-propan-2-ylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]cyclopropane-1-carboxamide (PubChem CID 11922985) has the molecular formula C22H23N3OS2 and a molecular weight of 409.58 g/mol. Its IUPAC name is cis-(1S,2R)-2-phenyl-N-[5-[(4-propan-2-ylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-2-phenyl-N-[5-[(4-propan-2-ylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 11922985 |
| Molecular Formula | C22H23N3OS2 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | cis-(1S,2R)-2-phenyl-N-[5-[(4-propan-2-ylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]cyclopropane-1-carboxamide |
| SMILES | CC(C)c1ccc(CSc2nnc(NC(=O)[C@H]3C[C@H]3c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C22H23N3OS2/c1-14(2)16-10-8-15(9-11-16)13-27-22-25-24-21(28-22)23-20(26)19-12-18(19)17-6-4-3-5-7-17/h3-11,14,18-19H,12-13H2,1-2H3,(H,23,24,26)/t18-,19-/m0/s1 |
| InChIKey | CHSOUIYDIVFZIA-OALUTQOASA-N |
| XLogP | 5.70 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|