C18H14ClN3O2S2 — CID 9112839
(2R)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-chloro-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 9112839) has the molecular formula C18H14ClN3O2S2 and a molecular weight of 403.92 g/mol. Its IUPAC name is (2R)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-chloro-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (2R)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-chloro-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 9112839 |
| Molecular Formula | C18H14ClN3O2S2 |
| Molecular Weight | 403.92 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | (2R)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-chloro-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2ccccc2)s1)[C@H]1Cc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C18H14ClN3O2S2/c19-13-6-7-14-12(8-13)9-15(24-14)16(23)20-17-21-22-18(26-17)25-10-11-4-2-1-3-5-11/h1-8,15H,9-10H2,(H,20,21,23)/t15-/m1/s1 |
| InChIKey | QSXYOPXWLBSIFO-OAHLLOKOSA-N |
| XLogP | 4.43 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.92 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|