C25H22N4O4S3 — CID 100694068
(2R)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-benzylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 100694068) has the molecular formula C25H22N4O4S3 and a molecular weight of 538.68 g/mol. Its IUPAC name is (2R)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-benzylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2R)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-benzylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 100694068 |
| Molecular Formula | C25H22N4O4S3 |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | (2R)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-benzylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2ccccc2)s1)[C@H]1CN(S(=O)(=O)Cc2ccccc2)c2ccccc2O1 |
| InChI | InChI=1S/C25H22N4O4S3/c30-23(26-24-27-28-25(35-24)34-16-18-9-3-1-4-10-18)22-15-29(20-13-7-8-14-21(20)33-22)36(31,32)17-19-11-5-2-6-12-19/h1-14,22H,15-17H2,(H,26,27,30)/t22-/m1/s1 |
| InChIKey | OVAXFWZRVNIFFE-JOCHJYFZSA-N |
| XLogP | 4.57 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|