C26H24N4O5S3 — CID 133161757
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(4-methoxyphenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133161757) has the molecular formula C26H24N4O5S3 and a molecular weight of 568.70 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(4-methoxyphenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(4-methoxyphenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133161757 |
| Molecular Formula | C26H24N4O5S3 |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(4-methoxyphenyl)sulfonyl-6-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CC(C(=O)Nc3nnc(SCc4ccccc4)s3)Oc3ccc(C)cc32)cc1 |
| InChI | InChI=1S/C26H24N4O5S3/c1-17-8-13-22-21(14-17)30(38(32,33)20-11-9-19(34-2)10-12-20)15-23(35-22)24(31)27-25-28-29-26(37-25)36-16-18-6-4-3-5-7-18/h3-14,23H,15-16H2,1-2H3,(H,27,28,31) |
| InChIKey | XRUKMZVJVNREHP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|