C25H21ClN4O4S3 — CID 133265139
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-6-chloro-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133265139) has the molecular formula C25H21ClN4O4S3 and a molecular weight of 573.12 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-6-chloro-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-6-chloro-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133265139 |
| Molecular Formula | C25H21ClN4O4S3 |
| Molecular Weight | 573.12 g/mol |
| Exact Mass | 572.04 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-6-chloro-4-(4-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C(=O)Nc3nnc(SCc4ccccc4)s3)Oc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C25H21ClN4O4S3/c1-16-7-10-19(11-8-16)37(32,33)30-14-22(34-21-12-9-18(26)13-20(21)30)23(31)27-24-28-29-25(36-24)35-15-17-5-3-2-4-6-17/h2-13,22H,14-15H2,1H3,(H,27,28,31) |
| InChIKey | ISTYGPASNWVIGT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.12 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|