C19H17ClN4O4S3 — CID 100533647
(2S)-4-(benzenesulfonyl)-6-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 100533647) has the molecular formula C19H17ClN4O4S3 and a molecular weight of 497.02 g/mol. Its IUPAC name is (2S)-4-(benzenesulfonyl)-6-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2S)-4-(benzenesulfonyl)-6-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 100533647 |
| Molecular Formula | C19H17ClN4O4S3 |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | (2S)-4-(benzenesulfonyl)-6-chloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CCSc1nnc(NC(=O)[C@@H]2CN(S(=O)(=O)c3ccccc3)c3cc(Cl)ccc3O2)s1 |
| InChI | InChI=1S/C19H17ClN4O4S3/c1-2-29-19-23-22-18(30-19)21-17(25)16-11-24(14-10-12(20)8-9-15(14)28-16)31(26,27)13-6-4-3-5-7-13/h3-10,16H,2,11H2,1H3,(H,21,22,25)/t16-/m0/s1 |
| InChIKey | DLRGABBMQPAVQA-INIZCTEOSA-N |
| XLogP | 3.90 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|