C20H17ClN4O4S3 — CID 133228127
4-(4-chlorophenyl)sulfonyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133228127) has the molecular formula C20H17ClN4O4S3 and a molecular weight of 509.03 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfonyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 4-(4-chlorophenyl)sulfonyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133228127 |
| Molecular Formula | C20H17ClN4O4S3 |
| Molecular Weight | 509.03 g/mol |
| Exact Mass | 508.01 |
| IUPAC Name | 4-(4-chlorophenyl)sulfonyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | C=CCSc1nnc(NC(=O)C2CN(S(=O)(=O)c3ccc(Cl)cc3)c3ccccc3O2)s1 |
| InChI | InChI=1S/C20H17ClN4O4S3/c1-2-11-30-20-24-23-19(31-20)22-18(26)17-12-25(15-5-3-4-6-16(15)29-17)32(27,28)14-9-7-13(21)8-10-14/h2-10,17H,1,11-12H2,(H,22,23,26) |
| InChIKey | QPGYMCFURWJFOR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.03 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|