C19H24N4O4S3 — CID 133178775
6-tert-butyl-4-methylsulfonyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133178775) has the molecular formula C19H24N4O4S3 and a molecular weight of 468.63 g/mol. Its IUPAC name is 6-tert-butyl-4-methylsulfonyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 6-tert-butyl-4-methylsulfonyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133178775 |
| Molecular Formula | C19H24N4O4S3 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 6-tert-butyl-4-methylsulfonyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | C=CCSc1nnc(NC(=O)C2CN(S(C)(=O)=O)c3cc(C(C)(C)C)ccc3O2)s1 |
| InChI | InChI=1S/C19H24N4O4S3/c1-6-9-28-18-22-21-17(29-18)20-16(24)15-11-23(30(5,25)26)13-10-12(19(2,3)4)7-8-14(13)27-15/h6-8,10,15H,1,9,11H2,2-5H3,(H,20,21,24) |
| InChIKey | XWTJYHOSQGRPRM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|