C20H20N4O4S3 — CID 133199919
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-6-methyl-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133199919) has the molecular formula C20H20N4O4S3 and a molecular weight of 476.61 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-6-methyl-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-6-methyl-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133199919 |
| Molecular Formula | C20H20N4O4S3 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-6-methyl-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1ccc2c(c1)N(S(C)(=O)=O)CC(C(=O)Nc1nnc(SCc3ccccc3)s1)O2 |
| InChI | InChI=1S/C20H20N4O4S3/c1-13-8-9-16-15(10-13)24(31(2,26)27)11-17(28-16)18(25)21-19-22-23-20(30-19)29-12-14-6-4-3-5-7-14/h3-10,17H,11-12H2,1-2H3,(H,21,22,25) |
| InChIKey | KSWYJBWBJXXQQI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|