C16H20N4O4S3 — CID 133159994
4-ethylsulfonyl-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133159994) has the molecular formula C16H20N4O4S3 and a molecular weight of 428.56 g/mol. Its IUPAC name is 4-ethylsulfonyl-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 4-ethylsulfonyl-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133159994 |
| Molecular Formula | C16H20N4O4S3 |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 4-ethylsulfonyl-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CCCSc1nnc(NC(=O)C2CN(S(=O)(=O)CC)c3ccccc3O2)s1 |
| InChI | InChI=1S/C16H20N4O4S3/c1-3-9-25-16-19-18-15(26-16)17-14(21)13-10-20(27(22,23)4-2)11-7-5-6-8-12(11)24-13/h5-8,13H,3-4,9-10H2,1-2H3,(H,17,18,21) |
| InChIKey | BBXQGMCAZQVXSL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|