C21H20N4O6S3 — CID 133210792
methyl 2-[[5-[(4-benzylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 133210792) has the molecular formula C21H20N4O6S3 and a molecular weight of 520.61 g/mol. Its IUPAC name is methyl 2-[[5-[(4-benzylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-[(4-benzylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 133210792 |
| Molecular Formula | C21H20N4O6S3 |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | methyl 2-[[5-[(4-benzylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nnc(NC(=O)C2CN(S(=O)(=O)Cc3ccccc3)c3ccccc3O2)s1 |
| InChI | InChI=1S/C21H20N4O6S3/c1-30-18(26)12-32-21-24-23-20(33-21)22-19(27)17-11-25(15-9-5-6-10-16(15)31-17)34(28,29)13-14-7-3-2-4-8-14/h2-10,17H,11-13H2,1H3,(H,22,23,27) |
| InChIKey | GGPWBIOZMRKSBY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|